C26H35N3O5 — CID 11547288
(2S,3R)-3-(4-benzylpiperazine-1-carbonyl)-6-(4-ethoxyphenyl)-N,2-dihydroxyhexanamide (PubChem CID 11547288) has the molecular formula C26H35N3O5 and a molecular weight of 469.58 g/mol. Its IUPAC name is (2S,3R)-3-(4-benzylpiperazine-1-carbonyl)-6-(4-ethoxyphenyl)-N,2-dihydroxyhexanamide.
| Compound Name | (2S,3R)-3-(4-benzylpiperazine-1-carbonyl)-6-(4-ethoxyphenyl)-N,2-dihydroxyhexanamide |
|---|---|
| PubChem CID | 11547288 |
| Molecular Formula | C26H35N3O5 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | (2S,3R)-3-(4-benzylpiperazine-1-carbonyl)-6-(4-ethoxyphenyl)-N,2-dihydroxyhexanamide |
| SMILES | CCOc1ccc(CCC[C@@H](C(=O)N2CCN(Cc3ccccc3)CC2)[C@H](O)C(=O)NO)cc1 |
| InChI | InChI=1S/C26H35N3O5/c1-2-34-22-13-11-20(12-14-22)9-6-10-23(24(30)25(31)27-33)26(32)29-17-15-28(16-18-29)19-21-7-4-3-5-8-21/h3-5,7-8,11-14,23-24,30,33H,2,6,9-10,15-19H2,1H3,(H,27,31)/t23-,24+/m1/s1 |
| InChIKey | FFRYMIRRVBMZAD-RPWUZVMVSA-N |
| XLogP | 2.23 |
| TPSA | 102.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|