C23H35N3O6 — CID 11662365
(2S,3R)-3-[4-[acetyl(methyl)amino]piperidine-1-carbonyl]-6-(4-ethoxyphenyl)-N,2-dihydroxyhexanamide (PubChem CID 11662365) has the molecular formula C23H35N3O6 and a molecular weight of 449.55 g/mol. Its IUPAC name is (2S,3R)-3-[4-[acetyl(methyl)amino]piperidine-1-carbonyl]-6-(4-ethoxyphenyl)-N,2-dihydroxyhexanamide.
| Compound Name | (2S,3R)-3-[4-[acetyl(methyl)amino]piperidine-1-carbonyl]-6-(4-ethoxyphenyl)-N,2-dihydroxyhexanamide |
|---|---|
| PubChem CID | 11662365 |
| Molecular Formula | C23H35N3O6 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.25 |
| IUPAC Name | (2S,3R)-3-[4-[acetyl(methyl)amino]piperidine-1-carbonyl]-6-(4-ethoxyphenyl)-N,2-dihydroxyhexanamide |
| SMILES | CCOc1ccc(CCC[C@@H](C(=O)N2CCC(N(C)C(C)=O)CC2)[C@H](O)C(=O)NO)cc1 |
| InChI | InChI=1S/C23H35N3O6/c1-4-32-19-10-8-17(9-11-19)6-5-7-20(21(28)22(29)24-31)23(30)26-14-12-18(13-15-26)25(3)16(2)27/h8-11,18,20-21,28,31H,4-7,12-15H2,1-3H3,(H,24,29)/t20-,21+/m1/s1 |
| InChIKey | PYGSTPROWGCGAT-RTWAWAEBSA-N |
| XLogP | 1.36 |
| TPSA | 119.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|