C24H34N6O7 — CID 11685000
(2S,3R)-3-[4-(4,6-dimethoxy-1,3,5-triazin-2-yl)piperazine-1-carbonyl]-6-(4-ethoxyphenyl)-N,2-dihydroxyhexanamide (PubChem CID 11685000) has the molecular formula C24H34N6O7 and a molecular weight of 518.57 g/mol. Its IUPAC name is (2S,3R)-3-[4-(4,6-dimethoxy-1,3,5-triazin-2-yl)piperazine-1-carbonyl]-6-(4-ethoxyphenyl)-N,2-dihydroxyhexanamide.
| Compound Name | (2S,3R)-3-[4-(4,6-dimethoxy-1,3,5-triazin-2-yl)piperazine-1-carbonyl]-6-(4-ethoxyphenyl)-N,2-dihydroxyhexanamide |
|---|---|
| PubChem CID | 11685000 |
| Molecular Formula | C24H34N6O7 |
| Molecular Weight | 518.57 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | (2S,3R)-3-[4-(4,6-dimethoxy-1,3,5-triazin-2-yl)piperazine-1-carbonyl]-6-(4-ethoxyphenyl)-N,2-dihydroxyhexanamide |
| SMILES | CCOc1ccc(CCC[C@@H](C(=O)N2CCN(c3nc(OC)nc(OC)n3)CC2)[C@H](O)C(=O)NO)cc1 |
| InChI | InChI=1S/C24H34N6O7/c1-4-37-17-10-8-16(9-11-17)6-5-7-18(19(31)20(32)28-34)21(33)29-12-14-30(15-13-29)22-25-23(35-2)27-24(26-22)36-3/h8-11,18-19,31,34H,4-7,12-15H2,1-3H3,(H,28,32)/t18-,19+/m1/s1 |
| InChIKey | HVWGXRLWVWCITM-MOPGFXCFSA-N |
| XLogP | 0.44 |
| TPSA | 159.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.57 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|