C25H31ClFN3O5 — CID 58487950
(2S,3R)-3-[4-(4-chloro-2-fluorophenyl)piperazine-1-carbonyl]-6-(4-ethoxyphenyl)-N,2-dihydroxyhexanamide (PubChem CID 58487950) has the molecular formula C25H31ClFN3O5 and a molecular weight of 507.99 g/mol. Its IUPAC name is (2S,3R)-3-[4-(4-chloro-2-fluorophenyl)piperazine-1-carbonyl]-6-(4-ethoxyphenyl)-N,2-dihydroxyhexanamide.
| Compound Name | (2S,3R)-3-[4-(4-chloro-2-fluorophenyl)piperazine-1-carbonyl]-6-(4-ethoxyphenyl)-N,2-dihydroxyhexanamide |
|---|---|
| PubChem CID | 58487950 |
| Molecular Formula | C25H31ClFN3O5 |
| Molecular Weight | 507.99 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | (2S,3R)-3-[4-(4-chloro-2-fluorophenyl)piperazine-1-carbonyl]-6-(4-ethoxyphenyl)-N,2-dihydroxyhexanamide |
| SMILES | CCOc1ccc(CCC[C@@H](C(=O)N2CCN(c3ccc(Cl)cc3F)CC2)[C@H](O)C(=O)NO)cc1 |
| InChI | InChI=1S/C25H31ClFN3O5/c1-2-35-19-9-6-17(7-10-19)4-3-5-20(23(31)24(32)28-34)25(33)30-14-12-29(13-15-30)22-11-8-18(26)16-21(22)27/h6-11,16,20,23,31,34H,2-5,12-15H2,1H3,(H,28,32)/t20-,23+/m1/s1 |
| InChIKey | HBQDYWDMQPWOPA-OFNKIYASSA-N |
| XLogP | 3.03 |
| TPSA | 102.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.99 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|