C26H34N2O5 — CID 89012665
(2S,3R)-6-(4-ethoxyphenyl)-2-hydroxy-3-[4-(4-methoxyphenyl)piperazine-1-carbonyl]hexanal (PubChem CID 89012665) has the molecular formula C26H34N2O5 and a molecular weight of 454.57 g/mol. Its IUPAC name is (2S,3R)-6-(4-ethoxyphenyl)-2-hydroxy-3-[4-(4-methoxyphenyl)piperazine-1-carbonyl]hexanal.
| Compound Name | (2S,3R)-6-(4-ethoxyphenyl)-2-hydroxy-3-[4-(4-methoxyphenyl)piperazine-1-carbonyl]hexanal |
|---|---|
| PubChem CID | 89012665 |
| Molecular Formula | C26H34N2O5 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | (2S,3R)-6-(4-ethoxyphenyl)-2-hydroxy-3-[4-(4-methoxyphenyl)piperazine-1-carbonyl]hexanal |
| SMILES | CCOc1ccc(CCC[C@@H](C(=O)N2CCN(c3ccc(OC)cc3)CC2)[C@H](O)C=O)cc1 |
| InChI | InChI=1S/C26H34N2O5/c1-3-33-23-11-7-20(8-12-23)5-4-6-24(25(30)19-29)26(31)28-17-15-27(16-18-28)21-9-13-22(32-2)14-10-21/h7-14,19,24-25,30H,3-6,15-18H2,1-2H3/t24-,25-/m1/s1 |
| InChIKey | YTQRXOXOWHFZDU-JWQCQUIFSA-N |
| XLogP | 2.94 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|