C14H18N2O4 — CID 94287158
2-[4-(4-ethoxyphenyl)piperazin-1-yl]-2-oxoacetic acid (PubChem CID 94287158) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is 2-[4-(4-ethoxyphenyl)piperazin-1-yl]-2-oxoacetic acid.
| Compound Name | 2-[4-(4-ethoxyphenyl)piperazin-1-yl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 94287158 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 2-[4-(4-ethoxyphenyl)piperazin-1-yl]-2-oxoacetic acid |
| SMILES | CCOc1ccc(N2CCN(C(=O)C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C14H18N2O4/c1-2-20-12-5-3-11(4-6-12)15-7-9-16(10-8-15)13(17)14(18)19/h3-6H,2,7-10H2,1H3,(H,18,19) |
| InChIKey | MPIFSJPGLVFREG-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|