C26H32N4O5 — CID 87360001
(2S,3R)-3-[4-(2-cyanophenyl)piperazine-1-carbonyl]-6-(4-ethoxyphenyl)-N,2-dihydroxyhexanamide (PubChem CID 87360001) has the molecular formula C26H32N4O5 and a molecular weight of 480.57 g/mol. Its IUPAC name is (2S,3R)-3-[4-(2-cyanophenyl)piperazine-1-carbonyl]-6-(4-ethoxyphenyl)-N,2-dihydroxyhexanamide.
| Compound Name | (2S,3R)-3-[4-(2-cyanophenyl)piperazine-1-carbonyl]-6-(4-ethoxyphenyl)-N,2-dihydroxyhexanamide |
|---|---|
| PubChem CID | 87360001 |
| Molecular Formula | C26H32N4O5 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | (2S,3R)-3-[4-(2-cyanophenyl)piperazine-1-carbonyl]-6-(4-ethoxyphenyl)-N,2-dihydroxyhexanamide |
| SMILES | CCOc1ccc(CCC[C@@H](C(=O)N2CCN(c3ccccc3C#N)CC2)[C@H](O)C(=O)NO)cc1 |
| InChI | InChI=1S/C26H32N4O5/c1-2-35-21-12-10-19(11-13-21)6-5-8-22(24(31)25(32)28-34)26(33)30-16-14-29(15-17-30)23-9-4-3-7-20(23)18-27/h3-4,7,9-13,22,24,31,34H,2,5-6,8,14-17H2,1H3,(H,28,32)/t22-,24+/m1/s1 |
| InChIKey | KDLBDHAMICBIIC-VWNXMTODSA-N |
| XLogP | 2.11 |
| TPSA | 126.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|