C25H39N3O7 — CID 11641727
tert-butyl (2S)-4-[(2R)-5-(4-ethoxyphenyl)-2-[(1S)-1-hydroxy-2-(hydroxyamino)-2-oxoethyl]pentanoyl]-2-methylpiperazine-1-carboxylate (PubChem CID 11641727) has the molecular formula C25H39N3O7 and a molecular weight of 493.60 g/mol. Its IUPAC name is tert-butyl (2S)-4-[(2R)-5-(4-ethoxyphenyl)-2-[(1S)-1-hydroxy-2-(hydroxyamino)-2-oxoethyl]pentanoyl]-2-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2S)-4-[(2R)-5-(4-ethoxyphenyl)-2-[(1S)-1-hydroxy-2-(hydroxyamino)-2-oxoethyl]pentanoyl]-2-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 11641727 |
| Molecular Formula | C25H39N3O7 |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.28 |
| IUPAC Name | tert-butyl (2S)-4-[(2R)-5-(4-ethoxyphenyl)-2-[(1S)-1-hydroxy-2-(hydroxyamino)-2-oxoethyl]pentanoyl]-2-methylpiperazine-1-carboxylate |
| SMILES | CCOc1ccc(CCC[C@@H](C(=O)N2CCN(C(=O)OC(C)(C)C)[C@@H](C)C2)[C@H](O)C(=O)NO)cc1 |
| InChI | InChI=1S/C25H39N3O7/c1-6-34-19-12-10-18(11-13-19)8-7-9-20(21(29)22(30)26-33)23(31)27-14-15-28(17(2)16-27)24(32)35-25(3,4)5/h10-13,17,20-21,29,33H,6-9,14-16H2,1-5H3,(H,26,30)/t17-,20+,21-/m0/s1 |
| InChIKey | TYVYKWBCVRYMTG-WMQCIHAUSA-N |
| XLogP | 2.36 |
| TPSA | 128.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|