C26H37N3O4 — CID 143172671
(3R)-6-(4-ethoxyphenyl)-3-[4-[[(3Z)-hexa-1,3,5-trien-2-yl]amino]piperidine-1-carbonyl]-N-hydroxyhexanamide (PubChem CID 143172671) has the molecular formula C26H37N3O4 and a molecular weight of 455.60 g/mol. Its IUPAC name is (3R)-6-(4-ethoxyphenyl)-3-[4-[[(3Z)-hexa-1,3,5-trien-2-yl]amino]piperidine-1-carbonyl]-N-hydroxyhexanamide.
| Compound Name | (3R)-6-(4-ethoxyphenyl)-3-[4-[[(3Z)-hexa-1,3,5-trien-2-yl]amino]piperidine-1-carbonyl]-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 143172671 |
| Molecular Formula | C26H37N3O4 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.28 |
| IUPAC Name | (3R)-6-(4-ethoxyphenyl)-3-[4-[[(3Z)-hexa-1,3,5-trien-2-yl]amino]piperidine-1-carbonyl]-N-hydroxyhexanamide |
| SMILES | C=C/C=C\C(=C)NC1CCN(C(=O)[C@H](CCCc2ccc(OCC)cc2)CC(=O)NO)CC1 |
| InChI | InChI=1S/C26H37N3O4/c1-4-6-8-20(3)27-23-15-17-29(18-16-23)26(31)22(19-25(30)28-32)10-7-9-21-11-13-24(14-12-21)33-5-2/h4,6,8,11-14,22-23,27,32H,1,3,5,7,9-10,15-19H2,2H3,(H,28,30)/b8-6-/t22-/m1/s1 |
| InChIKey | KENSTBGCTPEDIT-IOOHMRRSSA-N |
| XLogP | 3.76 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|