C24H34N4O5 — CID 143006284
2-hydroxy-6-(4-methoxyphenyl)-3-(4-pyridin-2-ylpiperazine-1-carbonyl)hexanal;N-methylhydroxylamine (PubChem CID 143006284) has the molecular formula C24H34N4O5 and a molecular weight of 458.56 g/mol. Its IUPAC name is 2-hydroxy-6-(4-methoxyphenyl)-3-(4-pyridin-2-ylpiperazine-1-carbonyl)hexanal;N-methylhydroxylamine.
| Compound Name | 2-hydroxy-6-(4-methoxyphenyl)-3-(4-pyridin-2-ylpiperazine-1-carbonyl)hexanal;N-methylhydroxylamine |
|---|---|
| PubChem CID | 143006284 |
| Molecular Formula | C24H34N4O5 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | 2-hydroxy-6-(4-methoxyphenyl)-3-(4-pyridin-2-ylpiperazine-1-carbonyl)hexanal;N-methylhydroxylamine |
| SMILES | CNO.COc1ccc(CCCC(C(=O)N2CCN(c3ccccn3)CC2)C(O)C=O)cc1 |
| InChI | InChI=1S/C23H29N3O4.CH5NO/c1-30-19-10-8-18(9-11-19)5-4-6-20(21(28)17-27)23(29)26-15-13-25(14-16-26)22-7-2-3-12-24-22;1-2-3/h2-3,7-12,17,20-21,28H,4-6,13-16H2,1H3;2-3H,1H3 |
| InChIKey | WKLYCSZLUNMZPQ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 115.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|