C38H40N6O4 — CID 155689137
phenylmethoxymethyl 4-[4-[[3-[[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]pyrimidin-2-yl]amino]-4-methylphenyl]carbamoyl]phenyl]piperazine-1-carboxylate (PubChem CID 155689137) has the molecular formula C38H40N6O4 and a molecular weight of 644.78 g/mol. Its IUPAC name is phenylmethoxymethyl 4-[4-[[3-[[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]pyrimidin-2-yl]amino]-4-methylphenyl]carbamoyl]phenyl]piperazine-1-carboxylate.
| Compound Name | phenylmethoxymethyl 4-[4-[[3-[[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]pyrimidin-2-yl]amino]-4-methylphenyl]carbamoyl]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 155689137 |
| Molecular Formula | C38H40N6O4 |
| Molecular Weight | 644.78 g/mol |
| Exact Mass | 644.31 |
| IUPAC Name | phenylmethoxymethyl 4-[4-[[3-[[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]pyrimidin-2-yl]amino]-4-methylphenyl]carbamoyl]phenyl]piperazine-1-carboxylate |
| SMILES | C=C/C(=C\C=C/C)c1ccnc(Nc2cc(NC(=O)c3ccc(N4CCN(C(=O)OCOCc5ccccc5)CC4)cc3)ccc2C)n1 |
| InChI | InChI=1S/C38H40N6O4/c1-4-6-12-30(5-2)34-19-20-39-37(41-34)42-35-25-32(16-13-28(35)3)40-36(45)31-14-17-33(18-15-31)43-21-23-44(24-22-43)38(46)48-27-47-26-29-10-8-7-9-11-29/h4-20,25H,2,21-24,26-27H2,1,3H3,(H,40,45)(H,39,41,42)/b6-4-,30-12+ |
| InChIKey | GRNHFQKQZZAURL-VCBMJTQQSA-N |
| XLogP | 7.36 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.78 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|