C38H50N2O9 — CID 170081301
tert-butyl 4-[(2R,3R,4S,5R,6R)-2,5,6-trihydroxy-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)heptanoyl]piperazine-1-carboxylate (PubChem CID 170081301) has the molecular formula C38H50N2O9 and a molecular weight of 678.82 g/mol. Its IUPAC name is tert-butyl 4-[(2R,3R,4S,5R,6R)-2,5,6-trihydroxy-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)heptanoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2R,3R,4S,5R,6R)-2,5,6-trihydroxy-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)heptanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 170081301 |
| Molecular Formula | C38H50N2O9 |
| Molecular Weight | 678.82 g/mol |
| Exact Mass | 678.35 |
| IUPAC Name | tert-butyl 4-[(2R,3R,4S,5R,6R)-2,5,6-trihydroxy-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)heptanoyl]piperazine-1-carboxylate |
| SMILES | C[C@@H](O)[C@](O)(COCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](O)C(=O)N1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C38H50N2O9/c1-28(41)38(45,27-46-24-29-14-8-5-9-15-29)34(48-26-31-18-12-7-13-19-31)33(47-25-30-16-10-6-11-17-30)32(42)35(43)39-20-22-40(23-21-39)36(44)49-37(2,3)4/h5-19,28,32-34,41-42,45H,20-27H2,1-4H3/t28-,32-,33-,34+,38-/m1/s1 |
| InChIKey | QNELAUBQQLQEHK-LFZQUHGESA-N |
| XLogP | 3.93 |
| TPSA | 138.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.82 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |