C22H33NO4 — CID 123743477
tert-butyl 4-(4-hydroxy-5-phenylmethoxypent-1-enyl)piperidine-1-carboxylate (PubChem CID 123743477) has the molecular formula C22H33NO4 and a molecular weight of 375.51 g/mol. Its IUPAC name is tert-butyl 4-(4-hydroxy-5-phenylmethoxypent-1-enyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-hydroxy-5-phenylmethoxypent-1-enyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 123743477 |
| Molecular Formula | C22H33NO4 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | tert-butyl 4-(4-hydroxy-5-phenylmethoxypent-1-enyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C=CCC(O)COCc2ccccc2)CC1 |
| InChI | InChI=1S/C22H33NO4/c1-22(2,3)27-21(25)23-14-12-18(13-15-23)10-7-11-20(24)17-26-16-19-8-5-4-6-9-19/h4-10,18,20,24H,11-17H2,1-3H3 |
| InChIKey | PZKJZOUMXADSHC-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|