C44H62N2O8 — CID 160529846
tert-butyl 4-ethynylpiperidine-1-carboxylate;tert-butyl 4-[(4R)-4-hydroxy-5-phenylmethoxypent-1-ynyl]piperidine-1-carboxylate;(2R)-2-(phenylmethoxymethyl)oxirane (PubChem CID 160529846) has the molecular formula C44H62N2O8 and a molecular weight of 746.99 g/mol. Its IUPAC name is tert-butyl 4-ethynylpiperidine-1-carboxylate;tert-butyl 4-[(4R)-4-hydroxy-5-phenylmethoxypent-1-ynyl]piperidine-1-carboxylate;(2R)-2-(phenylmethoxymethyl)oxirane.
| Compound Name | tert-butyl 4-ethynylpiperidine-1-carboxylate;tert-butyl 4-[(4R)-4-hydroxy-5-phenylmethoxypent-1-ynyl]piperidine-1-carboxylate;(2R)-2-(phenylmethoxymethyl)oxirane |
|---|---|
| PubChem CID | 160529846 |
| Molecular Formula | C44H62N2O8 |
| Molecular Weight | 746.99 g/mol |
| Exact Mass | 746.45 |
| IUPAC Name | tert-butyl 4-ethynylpiperidine-1-carboxylate;tert-butyl 4-[(4R)-4-hydroxy-5-phenylmethoxypent-1-ynyl]piperidine-1-carboxylate;(2R)-2-(phenylmethoxymethyl)oxirane |
| SMILES | C#CC1CCN(C(=O)OC(C)(C)C)CC1.CC(C)(C)OC(=O)N1CCC(C#CC[C@@H](O)COCc2ccccc2)CC1.c1ccc(COC[C@H]2CO2)cc1 |
| InChI | InChI=1S/C22H31NO4.C12H19NO2.C10H12O2/c1-22(2,3)27-21(25)23-14-12-18(13-15-23)10-7-11-20(24)17-26-16-19-8-5-4-6-9-19;1-5-10-6-8-13(9-7-10)11(14)15-12(2,3)4;1-2-4-9(5-3-1)6-11-7-10-8-12-10/h4-6,8-9,18,20,24H,11-17H2,1-3H3;1,10H,6-9H2,2-4H3;1-5,10H,6-8H2/t20-;;10-/m1.0/s1 |
| InChIKey | QVJXXFQJTIRLFH-PYOHFVPUSA-N |
| XLogP | 7.47 |
| TPSA | 110.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.99 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|