C26H36N2O7 — CID 166937587
(2R,3R,4S,6R)-2,3,5,6-tetrahydroxy-4-phenylmethoxy-5-(phenylmethoxymethyl)-1-piperazin-1-ylheptan-1-one (PubChem CID 166937587) has the molecular formula C26H36N2O7 and a molecular weight of 488.58 g/mol. Its IUPAC name is (2R,3R,4S,6R)-2,3,5,6-tetrahydroxy-4-phenylmethoxy-5-(phenylmethoxymethyl)-1-piperazin-1-ylheptan-1-one.
| Compound Name | (2R,3R,4S,6R)-2,3,5,6-tetrahydroxy-4-phenylmethoxy-5-(phenylmethoxymethyl)-1-piperazin-1-ylheptan-1-one |
|---|---|
| PubChem CID | 166937587 |
| Molecular Formula | C26H36N2O7 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | (2R,3R,4S,6R)-2,3,5,6-tetrahydroxy-4-phenylmethoxy-5-(phenylmethoxymethyl)-1-piperazin-1-ylheptan-1-one |
| SMILES | C[C@@H](O)C(O)(COCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](O)[C@@H](O)C(=O)N1CCNCC1 |
| InChI | InChI=1S/C26H36N2O7/c1-19(29)26(33,18-34-16-20-8-4-2-5-9-20)24(35-17-21-10-6-3-7-11-21)22(30)23(31)25(32)28-14-12-27-13-15-28/h2-11,19,22-24,27,29-31,33H,12-18H2,1H3/t19-,22-,23-,24+,26?/m1/s1 |
| InChIKey | FIAXTMHYXYLCGN-PYSAIDQVSA-N |
| XLogP | 0.05 |
| TPSA | 131.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |