C28H37FN2O2 — CID 167573618
1-[4-[fluoro(diphenyl)methyl]piperazin-1-yl]undecane-1,9-dione (PubChem CID 167573618) has the molecular formula C28H37FN2O2 and a molecular weight of 452.61 g/mol. Its IUPAC name is 1-[4-[fluoro(diphenyl)methyl]piperazin-1-yl]undecane-1,9-dione.
| Compound Name | 1-[4-[fluoro(diphenyl)methyl]piperazin-1-yl]undecane-1,9-dione |
|---|---|
| PubChem CID | 167573618 |
| Molecular Formula | C28H37FN2O2 |
| Molecular Weight | 452.61 g/mol |
| Exact Mass | 452.28 |
| IUPAC Name | 1-[4-[fluoro(diphenyl)methyl]piperazin-1-yl]undecane-1,9-dione |
| SMILES | CCC(=O)CCCCCCCC(=O)N1CCN(C(F)(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C28H37FN2O2/c1-2-26(32)18-12-4-3-5-13-19-27(33)30-20-22-31(23-21-30)28(29,24-14-8-6-9-15-24)25-16-10-7-11-17-25/h6-11,14-17H,2-5,12-13,18-23H2,1H3 |
| InChIKey | GFTMCZZJGBXWCH-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.61 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|