C17H34N2O — CID 126654356
1-(4-tert-butylpiperazin-1-yl)-6,6-dimethylheptan-1-one (PubChem CID 126654356) has the molecular formula C17H34N2O and a molecular weight of 282.47 g/mol. Its IUPAC name is 1-(4-tert-butylpiperazin-1-yl)-6,6-dimethylheptan-1-one.
| Compound Name | 1-(4-tert-butylpiperazin-1-yl)-6,6-dimethylheptan-1-one |
|---|---|
| PubChem CID | 126654356 |
| Molecular Formula | C17H34N2O |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.27 |
| IUPAC Name | 1-(4-tert-butylpiperazin-1-yl)-6,6-dimethylheptan-1-one |
| SMILES | CC(C)(C)CCCCC(=O)N1CCN(C(C)(C)C)CC1 |
| InChI | InChI=1S/C17H34N2O/c1-16(2,3)10-8-7-9-15(20)18-11-13-19(14-12-18)17(4,5)6/h7-14H2,1-6H3 |
| InChIKey | VGUFSTBHZPGIAX-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|