C26H50N4O2 — CID 150756332
1-[10-(7,7-dimethyloctanoyl)-1,8,9,10-tetrazabicyclo[6.1.1]decan-9-yl]-7,7-dimethyloctan-1-one (PubChem CID 150756332) has the molecular formula C26H50N4O2 and a molecular weight of 450.71 g/mol. Its IUPAC name is 1-[10-(7,7-dimethyloctanoyl)-1,8,9,10-tetrazabicyclo[6.1.1]decan-9-yl]-7,7-dimethyloctan-1-one.
| Compound Name | 1-[10-(7,7-dimethyloctanoyl)-1,8,9,10-tetrazabicyclo[6.1.1]decan-9-yl]-7,7-dimethyloctan-1-one |
|---|---|
| PubChem CID | 150756332 |
| Molecular Formula | C26H50N4O2 |
| Molecular Weight | 450.71 g/mol |
| Exact Mass | 450.39 |
| IUPAC Name | 1-[10-(7,7-dimethyloctanoyl)-1,8,9,10-tetrazabicyclo[6.1.1]decan-9-yl]-7,7-dimethyloctan-1-one |
| SMILES | CC(C)(C)CCCCCC(=O)N1N2CCCCCCN1N2C(=O)CCCCCC(C)(C)C |
| InChI | InChI=1S/C26H50N4O2/c1-25(2,3)19-13-9-11-17-23(31)29-27-21-15-7-8-16-22-28(29)30(27)24(32)18-12-10-14-20-26(4,5)6/h7-22H2,1-6H3 |
| InChIKey | JWXOSMBARRPDOH-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.71 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|