C15H30N2O — CID 138647099
7,7-dimethyl-1-(4-methylpiperazin-1-yl)octan-1-one (PubChem CID 138647099) has the molecular formula C15H30N2O and a molecular weight of 254.42 g/mol. Its IUPAC name is 7,7-dimethyl-1-(4-methylpiperazin-1-yl)octan-1-one.
| Compound Name | 7,7-dimethyl-1-(4-methylpiperazin-1-yl)octan-1-one |
|---|---|
| PubChem CID | 138647099 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | 7,7-dimethyl-1-(4-methylpiperazin-1-yl)octan-1-one |
| SMILES | CN1CCN(C(=O)CCCCCC(C)(C)C)CC1 |
| InChI | InChI=1S/C15H30N2O/c1-15(2,3)9-7-5-6-8-14(18)17-12-10-16(4)11-13-17/h5-13H2,1-4H3 |
| InChIKey | SVCWHNILOGZDLK-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|