C24H27F3N2O3 — CID 55831039
4-(2-phenylethoxy)-1-[4-[4-(trifluoromethyl)benzoyl]piperazin-1-yl]butan-1-one (PubChem CID 55831039) has the molecular formula C24H27F3N2O3 and a molecular weight of 448.49 g/mol. Its IUPAC name is 4-(2-phenylethoxy)-1-[4-[4-(trifluoromethyl)benzoyl]piperazin-1-yl]butan-1-one.
| Compound Name | 4-(2-phenylethoxy)-1-[4-[4-(trifluoromethyl)benzoyl]piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 55831039 |
| Molecular Formula | C24H27F3N2O3 |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 4-(2-phenylethoxy)-1-[4-[4-(trifluoromethyl)benzoyl]piperazin-1-yl]butan-1-one |
| SMILES | O=C(CCCOCCc1ccccc1)N1CCN(C(=O)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C24H27F3N2O3/c25-24(26,27)21-10-8-20(9-11-21)23(31)29-15-13-28(14-16-29)22(30)7-4-17-32-18-12-19-5-2-1-3-6-19/h1-3,5-6,8-11H,4,7,12-18H2 |
| InChIKey | IDTGJIXGDDXLBE-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|