C18H16F3NO4 — CID 169488153
2-amino-3-oxo-3-phenylmethoxy-2-[[3-(trifluoromethyl)phenyl]methyl]propanoic acid (PubChem CID 169488153) has the molecular formula C18H16F3NO4 and a molecular weight of 367.32 g/mol. Its IUPAC name is 2-amino-3-oxo-3-phenylmethoxy-2-[[3-(trifluoromethyl)phenyl]methyl]propanoic acid.
| Compound Name | 2-amino-3-oxo-3-phenylmethoxy-2-[[3-(trifluoromethyl)phenyl]methyl]propanoic acid |
|---|---|
| PubChem CID | 169488153 |
| Molecular Formula | C18H16F3NO4 |
| Molecular Weight | 367.32 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 2-amino-3-oxo-3-phenylmethoxy-2-[[3-(trifluoromethyl)phenyl]methyl]propanoic acid |
| SMILES | NC(Cc1cccc(C(F)(F)F)c1)(C(=O)O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H16F3NO4/c19-18(20,21)14-8-4-7-13(9-14)10-17(22,15(23)24)16(25)26-11-12-5-2-1-3-6-12/h1-9H,10-11,22H2,(H,23,24) |
| InChIKey | UVWVVTIIGZHRRJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.32 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|