C21H25NO5 — CID 174531027
2-amino-2-[[4-[(2-methylpropan-2-yl)oxy]phenyl]methyl]-3-oxo-3-phenylmethoxypropanoic acid (PubChem CID 174531027) has the molecular formula C21H25NO5 and a molecular weight of 371.43 g/mol. Its IUPAC name is 2-amino-2-[[4-[(2-methylpropan-2-yl)oxy]phenyl]methyl]-3-oxo-3-phenylmethoxypropanoic acid.
| Compound Name | 2-amino-2-[[4-[(2-methylpropan-2-yl)oxy]phenyl]methyl]-3-oxo-3-phenylmethoxypropanoic acid |
|---|---|
| PubChem CID | 174531027 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 2-amino-2-[[4-[(2-methylpropan-2-yl)oxy]phenyl]methyl]-3-oxo-3-phenylmethoxypropanoic acid |
| SMILES | CC(C)(C)Oc1ccc(CC(N)(C(=O)O)C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C21H25NO5/c1-20(2,3)27-17-11-9-15(10-12-17)13-21(22,18(23)24)19(25)26-14-16-7-5-4-6-8-16/h4-12H,13-14,22H2,1-3H3,(H,23,24) |
| InChIKey | AOLLCGMSYVXTSG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|