C12H11F3N2O — CID 126644745
N,N-dimethyl-5-(trifluoromethyl)-1H-indole-2-carboxamide (PubChem CID 126644745) has the molecular formula C12H11F3N2O and a molecular weight of 256.23 g/mol. Its IUPAC name is N,N-dimethyl-5-(trifluoromethyl)-1H-indole-2-carboxamide.
| Compound Name | N,N-dimethyl-5-(trifluoromethyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 126644745 |
| Molecular Formula | C12H11F3N2O |
| Molecular Weight | 256.23 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | N,N-dimethyl-5-(trifluoromethyl)-1H-indole-2-carboxamide |
| SMILES | CN(C)C(=O)c1cc2cc(C(F)(F)F)ccc2[nH]1 |
| InChI | InChI=1S/C12H11F3N2O/c1-17(2)11(18)10-6-7-5-8(12(13,14)15)3-4-9(7)16-10/h3-6,16H,1-2H3 |
| InChIKey | ZTIIAHBHJVDGFS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.23 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |