C21H22N4O3 — CID 167951270
N-[(2-ethylphenyl)methyl]-N'-[2-(methylcarbamoyl)-1H-indol-5-yl]oxamide (PubChem CID 167951270) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is N-[(2-ethylphenyl)methyl]-N'-[2-(methylcarbamoyl)-1H-indol-5-yl]oxamide.
| Compound Name | N-[(2-ethylphenyl)methyl]-N'-[2-(methylcarbamoyl)-1H-indol-5-yl]oxamide |
|---|---|
| PubChem CID | 167951270 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | N-[(2-ethylphenyl)methyl]-N'-[2-(methylcarbamoyl)-1H-indol-5-yl]oxamide |
| SMILES | CCc1ccccc1CNC(=O)C(=O)Nc1ccc2[nH]c(C(=O)NC)cc2c1 |
| InChI | InChI=1S/C21H22N4O3/c1-3-13-6-4-5-7-14(13)12-23-20(27)21(28)24-16-8-9-17-15(10-16)11-18(25-17)19(26)22-2/h4-11,25H,3,12H2,1-2H3,(H,22,26)(H,23,27)(H,24,28) |
| InChIKey | BGZNPHSGWZBKOB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 103.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|