C21H19N5O3 — CID 29147416
N-[2-(1H-indole-2-carbonylamino)ethyl]-N'-(1H-indol-5-yl)oxamide (PubChem CID 29147416) has the molecular formula C21H19N5O3 and a molecular weight of 389.42 g/mol. Its IUPAC name is N-[2-(1H-indole-2-carbonylamino)ethyl]-N'-(1H-indol-5-yl)oxamide.
| Compound Name | N-[2-(1H-indole-2-carbonylamino)ethyl]-N'-(1H-indol-5-yl)oxamide |
|---|---|
| PubChem CID | 29147416 |
| Molecular Formula | C21H19N5O3 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | N-[2-(1H-indole-2-carbonylamino)ethyl]-N'-(1H-indol-5-yl)oxamide |
| SMILES | O=C(NCCNC(=O)c1cc2ccccc2[nH]1)C(=O)Nc1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C21H19N5O3/c27-19(18-12-13-3-1-2-4-17(13)26-18)23-9-10-24-20(28)21(29)25-15-5-6-16-14(11-15)7-8-22-16/h1-8,11-12,22,26H,9-10H2,(H,23,27)(H,24,28)(H,25,29) |
| InChIKey | ZWOLAOXAYHLPGF-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 118.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|