C14H15N3O2 — CID 146087723
N-[2-(prop-2-enoylamino)ethyl]-1H-indole-2-carboxamide (PubChem CID 146087723) has the molecular formula C14H15N3O2 and a molecular weight of 257.29 g/mol. Its IUPAC name is N-[2-(prop-2-enoylamino)ethyl]-1H-indole-2-carboxamide.
| Compound Name | N-[2-(prop-2-enoylamino)ethyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 146087723 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | N-[2-(prop-2-enoylamino)ethyl]-1H-indole-2-carboxamide |
| SMILES | C=CC(=O)NCCNC(=O)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C14H15N3O2/c1-2-13(18)15-7-8-16-14(19)12-9-10-5-3-4-6-11(10)17-12/h2-6,9,17H,1,7-8H2,(H,15,18)(H,16,19) |
| InChIKey | XETVWBSGQPZLMU-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|