C25H23N3O2 — CID 83289883
N-benzyl-5-(3-phenylpropanoylamino)-1H-indole-2-carboxamide (PubChem CID 83289883) has the molecular formula C25H23N3O2 and a molecular weight of 397.48 g/mol. Its IUPAC name is N-benzyl-5-(3-phenylpropanoylamino)-1H-indole-2-carboxamide.
| Compound Name | N-benzyl-5-(3-phenylpropanoylamino)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 83289883 |
| Molecular Formula | C25H23N3O2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | N-benzyl-5-(3-phenylpropanoylamino)-1H-indole-2-carboxamide |
| SMILES | O=C(CCc1ccccc1)Nc1ccc2[nH]c(C(=O)NCc3ccccc3)cc2c1 |
| InChI | InChI=1S/C25H23N3O2/c29-24(14-11-18-7-3-1-4-8-18)27-21-12-13-22-20(15-21)16-23(28-22)25(30)26-17-19-9-5-2-6-10-19/h1-10,12-13,15-16,28H,11,14,17H2,(H,26,30)(H,27,29) |
| InChIKey | JWDKSJJNIQCKKQ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |