C18H19ClN2O3 — CID 44664335
N-benzyl-5,6-dimethoxy-1H-indole-2-carboxamide;hydrochloride (PubChem CID 44664335) has the molecular formula C18H19ClN2O3 and a molecular weight of 346.81 g/mol. Its IUPAC name is N-benzyl-5,6-dimethoxy-1H-indole-2-carboxamide;hydrochloride.
| Compound Name | N-benzyl-5,6-dimethoxy-1H-indole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 44664335 |
| Molecular Formula | C18H19ClN2O3 |
| Molecular Weight | 346.81 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | N-benzyl-5,6-dimethoxy-1H-indole-2-carboxamide;hydrochloride |
| SMILES | COc1cc2cc(C(=O)NCc3ccccc3)[nH]c2cc1OC.Cl |
| InChI | InChI=1S/C18H18N2O3.ClH/c1-22-16-9-13-8-15(20-14(13)10-17(16)23-2)18(21)19-11-12-6-4-3-5-7-12;/h3-10,20H,11H2,1-2H3,(H,19,21);1H |
| InChIKey | JRMHVCYCTYHOKA-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.81 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |