C20H22N2O4 — CID 162970638
N-(1-hydroxy-3-phenylpropan-2-yl)-5,6-dimethoxy-1H-indole-2-carboxamide (PubChem CID 162970638) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is N-(1-hydroxy-3-phenylpropan-2-yl)-5,6-dimethoxy-1H-indole-2-carboxamide.
| Compound Name | N-(1-hydroxy-3-phenylpropan-2-yl)-5,6-dimethoxy-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 162970638 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | N-(1-hydroxy-3-phenylpropan-2-yl)-5,6-dimethoxy-1H-indole-2-carboxamide |
| SMILES | COc1cc2cc(C(=O)NC(CO)Cc3ccccc3)[nH]c2cc1OC |
| InChI | InChI=1S/C20H22N2O4/c1-25-18-10-14-9-17(22-16(14)11-19(18)26-2)20(24)21-15(12-23)8-13-6-4-3-5-7-13/h3-7,9-11,15,22-23H,8,12H2,1-2H3,(H,21,24) |
| InChIKey | UDOSXDXLWFMELH-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 83.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |