C25H24N2O3 — CID 55694524
6-methoxy-N-[[4-(phenylmethoxymethyl)phenyl]methyl]-1H-indole-2-carboxamide (PubChem CID 55694524) has the molecular formula C25H24N2O3 and a molecular weight of 400.48 g/mol. Its IUPAC name is 6-methoxy-N-[[4-(phenylmethoxymethyl)phenyl]methyl]-1H-indole-2-carboxamide.
| Compound Name | 6-methoxy-N-[[4-(phenylmethoxymethyl)phenyl]methyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 55694524 |
| Molecular Formula | C25H24N2O3 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 6-methoxy-N-[[4-(phenylmethoxymethyl)phenyl]methyl]-1H-indole-2-carboxamide |
| SMILES | COc1ccc2cc(C(=O)NCc3ccc(COCc4ccccc4)cc3)[nH]c2c1 |
| InChI | InChI=1S/C25H24N2O3/c1-29-22-12-11-21-13-24(27-23(21)14-22)25(28)26-15-18-7-9-20(10-8-18)17-30-16-19-5-3-2-4-6-19/h2-14,27H,15-17H2,1H3,(H,26,28) |
| InChIKey | BVZHZJPZWULQIP-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |