C23H16BNO4S — CID 59755206
N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)pyrene-1-sulfonamide (PubChem CID 59755206) has the molecular formula C23H16BNO4S and a molecular weight of 413.26 g/mol. Its IUPAC name is N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)pyrene-1-sulfonamide.
| Compound Name | N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)pyrene-1-sulfonamide |
|---|---|
| PubChem CID | 59755206 |
| Molecular Formula | C23H16BNO4S |
| Molecular Weight | 413.26 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)pyrene-1-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc2c(c1)B(O)OC2)c1ccc2ccc3cccc4ccc1c2c34 |
| InChI | InChI=1S/C23H16BNO4S/c26-24-20-12-18(9-6-17(20)13-29-24)25-30(27,28)21-11-8-16-5-4-14-2-1-3-15-7-10-19(21)23(16)22(14)15/h1-12,25-26H,13H2 |
| InChIKey | CARAXBSFGZOASE-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.26 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|