About N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)pyrene-1-sulfonamide
N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)pyrene-1-sulfonamide (PubChem CID 59755206) has the molecular formula C23H16BNO4S
and a molecular weight of 413.26 g/mol. Its IUPAC name is N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)pyrene-1-sulfonamide.
Molecular Properties
| Compound Name | N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)pyrene-1-sulfonamide |
| PubChem CID | 59755206 |
| Molecular Formula | C23H16BNO4S |
| Molecular Weight | 413.26 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)pyrene-1-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc2c(c1)B(O)OC2)c1ccc2ccc3cccc4ccc1c2c34 |
| InChI | InChI=1S/C23H16BNO4S/c26-24-20-12-18(9-6-17(20)13-29-24)25-30(27,28)21-11-8-16-5-4-14-2-1-3-15-7-10-19(21)23(16)22(14)15/h1-12,25-26H,13H2 |
| InChIKey | CARAXBSFGZOASE-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.26 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)pyrene-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)pyrene-1-sulfonamide?
The IUPAC name of N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)pyrene-1-sulfonamide (CID 59755206) is N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)pyrene-1-sulfonamide.
What is the SMILES notation for N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)pyrene-1-sulfonamide?
The canonical SMILES for N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)pyrene-1-sulfonamide is O=S(=O)(Nc1ccc2c(c1)B(O)OC2)c1ccc2ccc3cccc4ccc1c2c34.
What is the InChIKey of N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)pyrene-1-sulfonamide?
The InChIKey is CARAXBSFGZOASE-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H16BNO4S/c26-24-20-12-18(9-6-17(20)13-29-24)25-30(27,28)21-11-8-16-5-4-14-2-1-3-15-7-10-19(21)23(16)22(14)15/h1-12,25-26H,13H2.
What are the key properties of N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)pyrene-1-sulfonamide?
N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)pyrene-1-sulfonamide has a molecular weight of 413.26 g/mol, XLogP of 3.60, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)pyrene-1-sulfonamide is sourced from PubChem (CID 59755206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).