C14H13BN2O6S — CID 86655221
[4-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)sulfamoyl]phenyl]carbamic acid (PubChem CID 86655221) has the molecular formula C14H13BN2O6S and a molecular weight of 348.15 g/mol. Its IUPAC name is [4-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)sulfamoyl]phenyl]carbamic acid.
| Compound Name | [4-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)sulfamoyl]phenyl]carbamic acid |
|---|---|
| PubChem CID | 86655221 |
| Molecular Formula | C14H13BN2O6S |
| Molecular Weight | 348.15 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | [4-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)sulfamoyl]phenyl]carbamic acid |
| SMILES | O=C(O)Nc1ccc(S(=O)(=O)Nc2ccc3c(c2)B(O)OC3)cc1 |
| InChI | InChI=1S/C14H13BN2O6S/c18-14(19)16-10-3-5-12(6-4-10)24(21,22)17-11-2-1-9-8-23-15(20)13(9)7-11/h1-7,16-17,20H,8H2,(H,18,19) |
| InChIKey | XDWJEHVCINFBRF-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.15 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|