C15H17BN2O4S — CID 67174381
4-amino-N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-2,6-dimethylbenzenesulfonamide (PubChem CID 67174381) has the molecular formula C15H17BN2O4S and a molecular weight of 332.19 g/mol. Its IUPAC name is 4-amino-N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-2,6-dimethylbenzenesulfonamide.
| Compound Name | 4-amino-N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-2,6-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 67174381 |
| Molecular Formula | C15H17BN2O4S |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 4-amino-N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-2,6-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(N)cc(C)c1S(=O)(=O)Nc1ccc2c(c1)B(O)OC2 |
| InChI | InChI=1S/C15H17BN2O4S/c1-9-5-12(17)6-10(2)15(9)23(20,21)18-13-4-3-11-8-22-16(19)14(11)7-13/h3-7,18-19H,8,17H2,1-2H3 |
| InChIKey | DXZCCWXDDKJACW-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|