C15H16BFN4O6S — CID 86657244
2-fluoroethyl N-[5-amino-2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)sulfamoyl]-3-pyridinyl]carbamate (PubChem CID 86657244) has the molecular formula C15H16BFN4O6S and a molecular weight of 410.19 g/mol. Its IUPAC name is 2-fluoroethyl N-[5-amino-2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)sulfamoyl]-3-pyridinyl]carbamate.
| Compound Name | 2-fluoroethyl N-[5-amino-2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)sulfamoyl]-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 86657244 |
| Molecular Formula | C15H16BFN4O6S |
| Molecular Weight | 410.19 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | 2-fluoroethyl N-[5-amino-2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)sulfamoyl]-3-pyridinyl]carbamate |
| SMILES | Nc1cnc(S(=O)(=O)Nc2ccc3c(c2)B(O)OC3)c(NC(=O)OCCF)c1 |
| InChI | InChI=1S/C15H16BFN4O6S/c17-3-4-26-15(22)20-13-5-10(18)7-19-14(13)28(24,25)21-11-2-1-9-8-27-16(23)12(9)6-11/h1-2,5-7,21,23H,3-4,8,18H2,(H,20,22) |
| InChIKey | VWJXBCXYHNVDMR-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 152.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.19 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|