C20H18BN3O6S — CID 58413809
phenyl N-[5-amino-2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)methylsulfonyl]-3-pyridinyl]carbamate (PubChem CID 58413809) has the molecular formula C20H18BN3O6S and a molecular weight of 439.26 g/mol. Its IUPAC name is phenyl N-[5-amino-2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)methylsulfonyl]-3-pyridinyl]carbamate.
| Compound Name | phenyl N-[5-amino-2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)methylsulfonyl]-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 58413809 |
| Molecular Formula | C20H18BN3O6S |
| Molecular Weight | 439.26 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | phenyl N-[5-amino-2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)methylsulfonyl]-3-pyridinyl]carbamate |
| SMILES | Nc1cnc(S(=O)(=O)Cc2ccc3c(c2)B(O)OC3)c(NC(=O)Oc2ccccc2)c1 |
| InChI | InChI=1S/C20H18BN3O6S/c22-15-9-18(24-20(25)30-16-4-2-1-3-5-16)19(23-10-15)31(27,28)12-13-6-7-14-11-29-21(26)17(14)8-13/h1-10,26H,11-12,22H2,(H,24,25) |
| InChIKey | UHZHFGOXVAFSQJ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 140.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.26 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|