C18H20BNO5S — CID 58343983
4-[5-amino-2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)methylsulfonyl]phenyl]butan-2-one (PubChem CID 58343983) has the molecular formula C18H20BNO5S and a molecular weight of 373.24 g/mol. Its IUPAC name is 4-[5-amino-2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)methylsulfonyl]phenyl]butan-2-one.
| Compound Name | 4-[5-amino-2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)methylsulfonyl]phenyl]butan-2-one |
|---|---|
| PubChem CID | 58343983 |
| Molecular Formula | C18H20BNO5S |
| Molecular Weight | 373.24 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 4-[5-amino-2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)methylsulfonyl]phenyl]butan-2-one |
| SMILES | CC(=O)CCc1cc(N)ccc1S(=O)(=O)Cc1ccc2c(c1)B(O)OC2 |
| InChI | InChI=1S/C18H20BNO5S/c1-12(21)2-4-14-9-16(20)6-7-18(14)26(23,24)11-13-3-5-15-10-25-19(22)17(15)8-13/h3,5-9,22H,2,4,10-11,20H2,1H3 |
| InChIKey | XKZHFDFALMLKSD-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.24 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|