C19H21BO6S — CID 123958905
carbon dioxide;1-hydroxy-6-[(4-methyl-2-propylphenyl)sulfonylmethyl]-3H-2,1-benzoxaborole (PubChem CID 123958905) has the molecular formula C19H21BO6S and a molecular weight of 388.25 g/mol. Its IUPAC name is carbon dioxide;1-hydroxy-6-[(4-methyl-2-propylphenyl)sulfonylmethyl]-3H-2,1-benzoxaborole.
| Compound Name | carbon dioxide;1-hydroxy-6-[(4-methyl-2-propylphenyl)sulfonylmethyl]-3H-2,1-benzoxaborole |
|---|---|
| PubChem CID | 123958905 |
| Molecular Formula | C19H21BO6S |
| Molecular Weight | 388.25 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | carbon dioxide;1-hydroxy-6-[(4-methyl-2-propylphenyl)sulfonylmethyl]-3H-2,1-benzoxaborole |
| SMILES | CCCc1cc(C)ccc1S(=O)(=O)Cc1ccc2c(c1)B(O)OC2.O=C=O |
| InChI | InChI=1S/C18H21BO4S.CO2/c1-3-4-15-9-13(2)5-8-18(15)24(21,22)12-14-6-7-16-11-23-19(20)17(16)10-14;2-1-3/h5-10,20H,3-4,11-12H2,1-2H3; |
| InChIKey | LCCIUQWBYDXYRW-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.25 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|