C19H21BO5S — CID 58413752
1-[4-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)methylsulfonyl]-2,5-dimethylphenyl]propan-2-one (PubChem CID 58413752) has the molecular formula C19H21BO5S and a molecular weight of 372.25 g/mol. Its IUPAC name is 1-[4-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)methylsulfonyl]-2,5-dimethylphenyl]propan-2-one.
| Compound Name | 1-[4-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)methylsulfonyl]-2,5-dimethylphenyl]propan-2-one |
|---|---|
| PubChem CID | 58413752 |
| Molecular Formula | C19H21BO5S |
| Molecular Weight | 372.25 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 1-[4-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)methylsulfonyl]-2,5-dimethylphenyl]propan-2-one |
| SMILES | CC(=O)Cc1cc(C)c(S(=O)(=O)Cc2ccc3c(c2)B(O)OC3)cc1C |
| InChI | InChI=1S/C19H21BO5S/c1-12-7-19(13(2)6-17(12)8-14(3)21)26(23,24)11-15-4-5-16-10-25-20(22)18(16)9-15/h4-7,9,22H,8,10-11H2,1-3H3 |
| InChIKey | XBXRPGFNPVXAAL-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.25 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|