C21H20BNO6S — CID 58344015
1-[4-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)methylsulfonyl]-3-(1,3-oxazol-2-ylmethyl)phenyl]propan-2-one (PubChem CID 58344015) has the molecular formula C21H20BNO6S and a molecular weight of 425.27 g/mol. Its IUPAC name is 1-[4-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)methylsulfonyl]-3-(1,3-oxazol-2-ylmethyl)phenyl]propan-2-one.
| Compound Name | 1-[4-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)methylsulfonyl]-3-(1,3-oxazol-2-ylmethyl)phenyl]propan-2-one |
|---|---|
| PubChem CID | 58344015 |
| Molecular Formula | C21H20BNO6S |
| Molecular Weight | 425.27 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | 1-[4-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)methylsulfonyl]-3-(1,3-oxazol-2-ylmethyl)phenyl]propan-2-one |
| SMILES | CC(=O)Cc1ccc(S(=O)(=O)Cc2ccc3c(c2)B(O)OC3)c(Cc2ncco2)c1 |
| InChI | InChI=1S/C21H20BNO6S/c1-14(24)8-15-3-5-20(18(9-15)11-21-23-6-7-28-21)30(26,27)13-16-2-4-17-12-29-22(25)19(17)10-16/h2-7,9-10,25H,8,11-13H2,1H3 |
| InChIKey | PGOPXQCDWHCYLO-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.27 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|