C15H16BN3O6S — CID 58413774
methyl N-[5-amino-2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)methylsulfonyl]-3-pyridinyl]carbamate (PubChem CID 58413774) has the molecular formula C15H16BN3O6S and a molecular weight of 377.19 g/mol. Its IUPAC name is methyl N-[5-amino-2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)methylsulfonyl]-3-pyridinyl]carbamate.
| Compound Name | methyl N-[5-amino-2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)methylsulfonyl]-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 58413774 |
| Molecular Formula | C15H16BN3O6S |
| Molecular Weight | 377.19 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | methyl N-[5-amino-2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)methylsulfonyl]-3-pyridinyl]carbamate |
| SMILES | COC(=O)Nc1cc(N)cnc1S(=O)(=O)Cc1ccc2c(c1)B(O)OC2 |
| InChI | InChI=1S/C15H16BN3O6S/c1-24-15(20)19-13-5-11(17)6-18-14(13)26(22,23)8-9-2-3-10-7-25-16(21)12(10)4-9/h2-6,21H,7-8,17H2,1H3,(H,19,20) |
| InChIKey | FWCIPOMVOMRTKQ-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 140.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.19 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|