C16H17BO5S — CID 58413776
1-hydroxy-6-[(4-methoxy-3-methylphenyl)sulfonylmethyl]-3H-2,1-benzoxaborole (PubChem CID 58413776) has the molecular formula C16H17BO5S and a molecular weight of 332.19 g/mol. Its IUPAC name is 1-hydroxy-6-[(4-methoxy-3-methylphenyl)sulfonylmethyl]-3H-2,1-benzoxaborole.
| Compound Name | 1-hydroxy-6-[(4-methoxy-3-methylphenyl)sulfonylmethyl]-3H-2,1-benzoxaborole |
|---|---|
| PubChem CID | 58413776 |
| Molecular Formula | C16H17BO5S |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 1-hydroxy-6-[(4-methoxy-3-methylphenyl)sulfonylmethyl]-3H-2,1-benzoxaborole |
| SMILES | COc1ccc(S(=O)(=O)Cc2ccc3c(c2)B(O)OC3)cc1C |
| InChI | InChI=1S/C16H17BO5S/c1-11-7-14(5-6-16(11)21-2)23(19,20)10-12-3-4-13-9-22-17(18)15(13)8-12/h3-8,18H,9-10H2,1-2H3 |
| InChIKey | TVPYZZUMJHGBNX-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|