C16H18BN3O6S — CID 58413782
ethyl N-[5-amino-2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)methylsulfonyl]-3-pyridinyl]carbamate (PubChem CID 58413782) has the molecular formula C16H18BN3O6S and a molecular weight of 391.21 g/mol. Its IUPAC name is ethyl N-[5-amino-2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)methylsulfonyl]-3-pyridinyl]carbamate.
| Compound Name | ethyl N-[5-amino-2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)methylsulfonyl]-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 58413782 |
| Molecular Formula | C16H18BN3O6S |
| Molecular Weight | 391.21 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | ethyl N-[5-amino-2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)methylsulfonyl]-3-pyridinyl]carbamate |
| SMILES | CCOC(=O)Nc1cc(N)cnc1S(=O)(=O)Cc1ccc2c(c1)B(O)OC2 |
| InChI | InChI=1S/C16H18BN3O6S/c1-2-25-16(21)20-14-6-12(18)7-19-15(14)27(23,24)9-10-3-4-11-8-26-17(22)13(11)5-10/h3-7,22H,2,8-9,18H2,1H3,(H,20,21) |
| InChIKey | OKSFAOQTEJHKMC-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 140.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.21 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|