C21H25BN2O8S — CID 67174527
[3-(ethoxycarbonylamino)-4-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)sulfamoyl]phenyl] 2,2-dimethylpropanoate (PubChem CID 67174527) has the molecular formula C21H25BN2O8S and a molecular weight of 476.32 g/mol. Its IUPAC name is [3-(ethoxycarbonylamino)-4-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)sulfamoyl]phenyl] 2,2-dimethylpropanoate.
| Compound Name | [3-(ethoxycarbonylamino)-4-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)sulfamoyl]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 67174527 |
| Molecular Formula | C21H25BN2O8S |
| Molecular Weight | 476.32 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | [3-(ethoxycarbonylamino)-4-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)sulfamoyl]phenyl] 2,2-dimethylpropanoate |
| SMILES | CCOC(=O)Nc1cc(OC(=O)C(C)(C)C)ccc1S(=O)(=O)Nc1ccc2c(c1)B(O)OC2 |
| InChI | InChI=1S/C21H25BN2O8S/c1-5-30-20(26)23-17-11-15(32-19(25)21(2,3)4)8-9-18(17)33(28,29)24-14-7-6-13-12-31-22(27)16(13)10-14/h6-11,24,27H,5,12H2,1-4H3,(H,23,26) |
| InChIKey | WYVQWFWROVZWKP-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 140.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|