C15H15BN2O7S — CID 123621533
[2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)sulfamoyl]-5-methoxyphenyl]carbamic acid (PubChem CID 123621533) has the molecular formula C15H15BN2O7S and a molecular weight of 378.17 g/mol. Its IUPAC name is [2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)sulfamoyl]-5-methoxyphenyl]carbamic acid.
| Compound Name | [2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)sulfamoyl]-5-methoxyphenyl]carbamic acid |
|---|---|
| PubChem CID | 123621533 |
| Molecular Formula | C15H15BN2O7S |
| Molecular Weight | 378.17 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | [2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)sulfamoyl]-5-methoxyphenyl]carbamic acid |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc3c(c2)B(O)OC3)c(NC(=O)O)c1 |
| InChI | InChI=1S/C15H15BN2O7S/c1-24-11-4-5-14(13(7-11)17-15(19)20)26(22,23)18-10-3-2-9-8-25-16(21)12(9)6-10/h2-7,17-18,21H,8H2,1H3,(H,19,20) |
| InChIKey | JVFYFWHGAQEMIL-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.17 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|