C15H17BN2O5S — CID 67174531
4-amino-N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-2-(2-hydroxyethyl)benzenesulfonamide (PubChem CID 67174531) has the molecular formula C15H17BN2O5S and a molecular weight of 348.19 g/mol. Its IUPAC name is 4-amino-N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-2-(2-hydroxyethyl)benzenesulfonamide.
| Compound Name | 4-amino-N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-2-(2-hydroxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 67174531 |
| Molecular Formula | C15H17BN2O5S |
| Molecular Weight | 348.19 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 4-amino-N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-2-(2-hydroxyethyl)benzenesulfonamide |
| SMILES | Nc1ccc(S(=O)(=O)Nc2ccc3c(c2)B(O)OC3)c(CCO)c1 |
| InChI | InChI=1S/C15H17BN2O5S/c17-12-2-4-15(10(7-12)5-6-19)24(21,22)18-13-3-1-11-9-23-16(20)14(11)8-13/h1-4,7-8,18-20H,5-6,9,17H2 |
| InChIKey | BFPFETDLKKVSQI-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.19 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|