C12H12BNO6S — CID 59525453
N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-5-(hydroxymethyl)furan-2-sulfonamide (PubChem CID 59525453) has the molecular formula C12H12BNO6S and a molecular weight of 309.11 g/mol. Its IUPAC name is N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-5-(hydroxymethyl)furan-2-sulfonamide.
| Compound Name | N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-5-(hydroxymethyl)furan-2-sulfonamide |
|---|---|
| PubChem CID | 59525453 |
| Molecular Formula | C12H12BNO6S |
| Molecular Weight | 309.11 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-5-(hydroxymethyl)furan-2-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc2c(c1)B(O)OC2)c1ccc(CO)o1 |
| InChI | InChI=1S/C12H12BNO6S/c15-6-10-3-4-12(20-10)21(17,18)14-9-2-1-8-7-19-13(16)11(8)5-9/h1-5,14-16H,6-7H2 |
| InChIKey | CMOLUSMMUWKMEN-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.11 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|