C19H23BN2O6S — CID 52950291
N-butyl-2-[2-hydroxy-5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)sulfamoyl]phenyl]acetamide (PubChem CID 52950291) has the molecular formula C19H23BN2O6S and a molecular weight of 418.28 g/mol. Its IUPAC name is N-butyl-2-[2-hydroxy-5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)sulfamoyl]phenyl]acetamide.
| Compound Name | N-butyl-2-[2-hydroxy-5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 52950291 |
| Molecular Formula | C19H23BN2O6S |
| Molecular Weight | 418.28 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | N-butyl-2-[2-hydroxy-5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)sulfamoyl]phenyl]acetamide |
| SMILES | CCCCNC(=O)Cc1cc(S(=O)(=O)Nc2ccc3c(c2)B(O)OC3)ccc1O |
| InChI | InChI=1S/C19H23BN2O6S/c1-2-3-8-21-19(24)10-14-9-16(6-7-18(14)23)29(26,27)22-15-5-4-13-12-28-20(25)17(13)11-15/h4-7,9,11,22-23,25H,2-3,8,10,12H2,1H3,(H,21,24) |
| InChIKey | ASHQKAWOHFDRIY-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.28 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|