C11H14BNO3S — CID 147711467
S-propyl N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)carbamothioate (PubChem CID 147711467) has the molecular formula C11H14BNO3S and a molecular weight of 251.12 g/mol. Its IUPAC name is S-propyl N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)carbamothioate.
| Compound Name | S-propyl N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)carbamothioate |
|---|---|
| PubChem CID | 147711467 |
| Molecular Formula | C11H14BNO3S |
| Molecular Weight | 251.12 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | S-propyl N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)carbamothioate |
| SMILES | CCCSC(=O)Nc1ccc2c(c1)B(O)OC2 |
| InChI | InChI=1S/C11H14BNO3S/c1-2-5-17-11(14)13-9-4-3-8-7-16-12(15)10(8)6-9/h3-4,6,15H,2,5,7H2,1H3,(H,13,14) |
| InChIKey | GUUFRYIIXBIPMK-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.12 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|