C15H24BNO3 — CID 143267078
ethane;N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-2,2-dimethylbutanamide (PubChem CID 143267078) has the molecular formula C15H24BNO3 and a molecular weight of 277.17 g/mol. Its IUPAC name is ethane;N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-2,2-dimethylbutanamide.
| Compound Name | ethane;N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-2,2-dimethylbutanamide |
|---|---|
| PubChem CID | 143267078 |
| Molecular Formula | C15H24BNO3 |
| Molecular Weight | 277.17 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | ethane;N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-2,2-dimethylbutanamide |
| SMILES | CC.CCC(C)(C)C(=O)Nc1ccc2c(c1)B(O)OC2 |
| InChI | InChI=1S/C13H18BNO3.C2H6/c1-4-13(2,3)12(16)15-10-6-5-9-8-18-14(17)11(9)7-10;1-2/h5-7,17H,4,8H2,1-3H3,(H,15,16);1-2H3 |
| InChIKey | ZOKAVFRJCINMOX-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.17 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|