C16H25BN2O3 — CID 166496233
N-[3-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)amino]propyl]-2,2-dimethylbutanamide (PubChem CID 166496233) has the molecular formula C16H25BN2O3 and a molecular weight of 304.20 g/mol. Its IUPAC name is N-[3-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)amino]propyl]-2,2-dimethylbutanamide.
| Compound Name | N-[3-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)amino]propyl]-2,2-dimethylbutanamide |
|---|---|
| PubChem CID | 166496233 |
| Molecular Formula | C16H25BN2O3 |
| Molecular Weight | 304.20 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | N-[3-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)amino]propyl]-2,2-dimethylbutanamide |
| SMILES | CCC(C)(C)C(=O)NCCCNc1ccc2c(c1)COB2O |
| InChI | InChI=1S/C16H25BN2O3/c1-4-16(2,3)15(20)19-9-5-8-18-13-6-7-14-12(10-13)11-22-17(14)21/h6-7,10,18,21H,4-5,8-9,11H2,1-3H3,(H,19,20) |
| InChIKey | VFITVKBBUOOKST-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.20 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|